Informação sobre produto
Nome:Triptophenolide methyl ether
Sinónimos:
- Hypolide methyl ether
Marca:Biosynth
Descrição:Triptophenolide methyl ether is a bioactive compound, classified as a terpene, derived from natural plant sources. It is primarily isolated from the roots of species within the *Tripterygium* genus. Terpenes are a large and varied class of organic compounds produced by a variety of plants, known for their aromatic qualities and biological activity.
The mode of action of triptophenolide methyl ether involves modulation of specific cellular pathways, often influencing inflammatory responses and immune-related processes. This mechanism is attributed to its interaction with key signaling molecules within cells, leading to altered gene expression and cellular function.
Because of these properties, triptophenolide methyl ether is of significant interest in scientific research, particularly for its potential therapeutic applications. It is being studied for its role in anti-inflammatory, immunosuppressive, and anticancer activities. Researchers are exploring its potential use in developing treatments for complex diseases such as autoimmune disorders and various cancers. Its study not only contributes to understanding complex biochemical pathways but also aids in the development of novel pharmaceutical agents.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:326.43 g/mol
Fórmula:C21H26O3
Pureza:Min. 95%
InChI:InChI=1S/C21H26O3/c1-12(2)13-5-7-17-15(19(13)23-4)6-8-18-16-11-24-20(22)14(16)9-10-21(17,18)3/h5,7,12,18H,6,8-11H2,1-4H3/t18-,21+/m0/s1
Chave InChI:InChIKey=JQYCSQASGZODFD-GHTZIAJQSA-N
SMILES:COc1c(C(C)C)ccc2c1CC[C@H]1C3=C(CC[C@]21C)C(=O)OC3
Consulta técnica sobre Triptophenolide methyl ether
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.