

trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine
CAS:
Ref. 3D-UHA23366


Informação sobre produto
Nome:trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine
Marca:Biosynth
Descrição:Trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine is a synthetic chemical with the chemical formula CH2=C(CH3)2OSi(CH2)2CH2N(CH3)2. It is an asymmetric synthesis of a benzocoumarin that has been shown to have hypoglycemic effects. Trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine is a constant pressure reactant in the homerwadsworthemmons reaction and was used to demonstrate the dehydration mechanism. This compound also has a chloride group and electron deficient carbonyl group that can be used for other reactions. Trans 3-(tertbutyldimethylsilyloxy)-N,Ndimethyl 1,3 butadiene 1
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:227.42 g/mol
Fórmula:C12H25NOSi
Pureza:Min. 95%