Informação sobre produto
Nome:Daphnetin-8-methyl ether
Sinónimos:
- Hydrangetin
Marca:Biosynth
Descrição:Daphnetin-8-methyl ether is a naturally derived coumarin compound, which is predominantly sourced from the Daphne genus of plants, among other botanical species known for their therapeutic potential. This compound is recognized for its biochemical interaction with key cellular pathways, particularly through the modulation of enzymes and receptors associated with inflammatory and oxidative stress responses.
The mode of action involves the inhibition of specific kinase pathways, which plays a crucial role in reducing inflammatory mediators and oxidative damage at the cellular level. This precise interaction highlights its potential utility in therapeutic research, particularly concerning inflammatory diseases and oxidative stress-related conditions.
In scientific research, Daphnetin-8-methyl ether is explored for its applications in pharmacological studies focusing on chronic inflammation, neuroprotection, and other health conditions where oxidative stress is a contributing factor. Given its origin and biological activity, this compound serves as a pivotal subject for biochemical investigations aiming to elucidate novel therapeutic approaches and drug development pathways.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:192.17 g/mol
Fórmula:C10H8O4
Pureza:Min. 95%
InChI:InChI=1S/C10H8O4/c1-13-10-7(11)4-2-6-3-5-8(12)14-9(6)10/h2-5,11H,1H3
Chave InChI:InChIKey=HAQWEMHXSIRYBE-UHFFFAOYSA-N
SMILES:COc1c(O)ccc2ccc(=O)oc12
Consulta técnica sobre Daphnetin-8-methyl ether
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.